C21H25ClN4O3 — CID 111075287
2-[4-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide (PubChem CID 111075287) has the molecular formula C21H25ClN4O3 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[4-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 111075287 |
| Molecular Formula | C21H25ClN4O3 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[4-[2-[[amino-(3-chloro-4-methoxyanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
| SMILES | COc1ccc(N/C(N)=N/CCc2ccc(OCC(=O)NC3CC3)cc2)cc1Cl |
| InChI | InChI=1S/C21H25ClN4O3/c1-28-19-9-6-16(12-18(19)22)26-21(23)24-11-10-14-2-7-17(8-3-14)29-13-20(27)25-15-4-5-15/h2-3,6-9,12,15H,4-5,10-11,13H2,1H3,(H,25,27)(H3,23,24,26) |
| InChIKey | JMLWVBFMGGWBDT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|