C20H24ClN3O4 — CID 119717548
2-(4-aminophenyl)-N-[3-[2-(cyclopropylamino)-2-oxoethoxy]-4-methoxyphenyl]acetamide;hydrochloride (PubChem CID 119717548) has the molecular formula C20H24ClN3O4 and a molecular weight of 405.88 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-[3-[2-(cyclopropylamino)-2-oxoethoxy]-4-methoxyphenyl]acetamide;hydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-[3-[2-(cyclopropylamino)-2-oxoethoxy]-4-methoxyphenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119717548 |
| Molecular Formula | C20H24ClN3O4 |
| Molecular Weight | 405.88 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-(4-aminophenyl)-N-[3-[2-(cyclopropylamino)-2-oxoethoxy]-4-methoxyphenyl]acetamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)Cc2ccc(N)cc2)cc1OCC(=O)NC1CC1.Cl |
| InChI | InChI=1S/C20H23N3O4.ClH/c1-26-17-9-8-16(11-18(17)27-12-20(25)22-15-6-7-15)23-19(24)10-13-2-4-14(21)5-3-13;/h2-5,8-9,11,15H,6-7,10,12,21H2,1H3,(H,22,25)(H,23,24);1H |
| InChIKey | LDPJEAYYMPLPSB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.88 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|