C22H28N4O2 — CID 111075261
2-[4-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide (PubChem CID 111075261) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[4-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide.
| Compound Name | 2-[4-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 111075261 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[4-[2-[[amino-(3-ethylanilino)methylidene]amino]ethyl]phenoxy]-N-cyclopropylacetamide |
| SMILES | CCc1cccc(N/C(N)=N/CCc2ccc(OCC(=O)NC3CC3)cc2)c1 |
| InChI | InChI=1S/C22H28N4O2/c1-2-16-4-3-5-19(14-16)26-22(23)24-13-12-17-6-10-20(11-7-17)28-15-21(27)25-18-8-9-18/h3-7,10-11,14,18H,2,8-9,12-13,15H2,1H3,(H,25,27)(H3,23,24,26) |
| InChIKey | IJYVRMCZSUUZNL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|