C16H26N2O3 — CID 38221992
1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methylpentyl)urea (PubChem CID 38221992) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methylpentyl)urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methylpentyl)urea |
|---|---|
| PubChem CID | 38221992 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(4-methylpentyl)urea |
| SMILES | COc1ccc(CNC(=O)NCCCC(C)C)cc1OC |
| InChI | InChI=1S/C16H26N2O3/c1-12(2)6-5-9-17-16(19)18-11-13-7-8-14(20-3)15(10-13)21-4/h7-8,10,12H,5-6,9,11H2,1-4H3,(H2,17,18,19) |
| InChIKey | DYWDUHAEWSKQLJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|