C14H23N3O3 — CID 108896807
1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)ethyl]urea (PubChem CID 108896807) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 108896807 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[2-(dimethylamino)ethyl]urea |
| SMILES | COc1ccc(CNC(=O)NCCN(C)C)cc1OC |
| InChI | InChI=1S/C14H23N3O3/c1-17(2)8-7-15-14(18)16-10-11-5-6-12(19-3)13(9-11)20-4/h5-6,9H,7-8,10H2,1-4H3,(H2,15,16,18) |
| InChIKey | ACWPDEBBZVQKMV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |