C19H28N2O4 — CID 108978428
1-N'-[(3,4-dimethoxyphenyl)methyl]-1-N-(3-methylbutyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108978428) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is 1-N'-[(3,4-dimethoxyphenyl)methyl]-1-N-(3-methylbutyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(3,4-dimethoxyphenyl)methyl]-1-N-(3-methylbutyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108978428 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-N'-[(3,4-dimethoxyphenyl)methyl]-1-N-(3-methylbutyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)C2(C(=O)NCCC(C)C)CC2)cc1OC |
| InChI | InChI=1S/C19H28N2O4/c1-13(2)7-10-20-17(22)19(8-9-19)18(23)21-12-14-5-6-15(24-3)16(11-14)25-4/h5-6,11,13H,7-10,12H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | VEDBUFAETVYOOT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|