C20H22N2O4 — CID 42934544
1-[1-(1-benzofuran-2-yl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 42934544) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42934544 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 1-[1-(1-benzofuran-2-yl)ethyl]-3-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)NC(C)c2cc3ccccc3o2)cc1OC |
| InChI | InChI=1S/C20H22N2O4/c1-13(18-11-15-6-4-5-7-16(15)26-18)22-20(23)21-12-14-8-9-17(24-2)19(10-14)25-3/h4-11,13H,12H2,1-3H3,(H2,21,22,23) |
| InChIKey | BJGUQMFMGGVHNY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |