C15H22F2N2O4 — CID 95282179
1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea (PubChem CID 95282179) has the molecular formula C15H22F2N2O4 and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea.
| Compound Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea |
|---|---|
| PubChem CID | 95282179 |
| Molecular Formula | C15H22F2N2O4 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-[(2S)-1-methoxypropan-2-yl]urea |
| SMILES | COC[C@H](C)NC(=O)NCCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H22F2N2O4/c1-10(9-21-2)19-15(20)18-7-6-11-4-5-12(22-3)13(8-11)23-14(16)17/h4-5,8,10,14H,6-7,9H2,1-3H3,(H2,18,19,20)/t10-/m0/s1 |
| InChIKey | KDAPNMQKWOBWRB-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |