C16H24F2N2O3 — CID 119767861
2-amino-N-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-methylpentanamide (PubChem CID 119767861) has the molecular formula C16H24F2N2O3 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-amino-N-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 119767861 |
| Molecular Formula | C16H24F2N2O3 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 2-amino-N-[2-[3-(difluoromethoxy)-4-methoxyphenyl]ethyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NCCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C16H24F2N2O3/c1-4-10(2)14(19)15(21)20-8-7-11-5-6-12(22-3)13(9-11)23-16(17)18/h5-6,9-10,14,16H,4,7-8,19H2,1-3H3,(H,20,21) |
| InChIKey | NGPWYCJIVLRXGQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |