C14H20ClNO4S2 — CID 44660329
2-[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]sulfanylacetic acid;hydrochloride (PubChem CID 44660329) has the molecular formula C14H20ClNO4S2 and a molecular weight of 365.90 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]sulfanylacetic acid;hydrochloride.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]sulfanylacetic acid;hydrochloride |
|---|---|
| PubChem CID | 44660329 |
| Molecular Formula | C14H20ClNO4S2 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-methylcarbamothioyl]sulfanylacetic acid;hydrochloride |
| SMILES | COc1ccc(CCN(C)C(=S)SCC(=O)O)cc1OC.Cl |
| InChI | InChI=1S/C14H19NO4S2.ClH/c1-15(14(20)21-9-13(16)17)7-6-10-4-5-11(18-2)12(8-10)19-3;/h4-5,8H,6-7,9H2,1-3H3,(H,16,17);1H |
| InChIKey | QQWJAZSXGUMGSY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|