C18H25NO5S — CID 88769890
2-[2-(3,4-dimethoxyphenyl)ethyl-(2-methyl-4-oxopentanethioyl)amino]acetic acid (PubChem CID 88769890) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethyl-(2-methyl-4-oxopentanethioyl)amino]acetic acid.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-(2-methyl-4-oxopentanethioyl)amino]acetic acid |
|---|---|
| PubChem CID | 88769890 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethyl-(2-methyl-4-oxopentanethioyl)amino]acetic acid |
| SMILES | COc1ccc(CCN(CC(=O)O)C(=S)C(C)CC(C)=O)cc1OC |
| InChI | InChI=1S/C18H25NO5S/c1-12(9-13(2)20)18(25)19(11-17(21)22)8-7-14-5-6-15(23-3)16(10-14)24-4/h5-6,10,12H,7-9,11H2,1-4H3,(H,21,22) |
| InChIKey | DOOBMCRCVNWVAC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|