C29H41F4N — CID 151672392
N-[(4-tert-butylphenyl)methyl]-2-[3-fluoro-5-(10,10,10-trifluorodecyl)phenyl]ethanamine (PubChem CID 151672392) has the molecular formula C29H41F4N and a molecular weight of 479.65 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-2-[3-fluoro-5-(10,10,10-trifluorodecyl)phenyl]ethanamine.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-2-[3-fluoro-5-(10,10,10-trifluorodecyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 151672392 |
| Molecular Formula | C29H41F4N |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.32 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-2-[3-fluoro-5-(10,10,10-trifluorodecyl)phenyl]ethanamine |
| SMILES | CC(C)(C)c1ccc(CNCCc2cc(F)cc(CCCCCCCCCC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H41F4N/c1-28(2,3)26-14-12-23(13-15-26)22-34-18-16-25-19-24(20-27(30)21-25)11-9-7-5-4-6-8-10-17-29(31,32)33/h12-15,19-21,34H,4-11,16-18,22H2,1-3H3 |
| InChIKey | QYVCVLYECSXZKH-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|