C20H23F4N — CID 58568398
2-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[[4-(2-methylpropyl)phenyl]methyl]ethanamine (PubChem CID 58568398) has the molecular formula C20H23F4N and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[[4-(2-methylpropyl)phenyl]methyl]ethanamine.
| Compound Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[[4-(2-methylpropyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 58568398 |
| Molecular Formula | C20H23F4N |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]-N-[[4-(2-methylpropyl)phenyl]methyl]ethanamine |
| SMILES | CC(C)Cc1ccc(CNCCc2cc(F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H23F4N/c1-14(2)9-15-3-5-16(6-4-15)13-25-8-7-17-10-18(20(22,23)24)12-19(21)11-17/h3-6,10-12,14,25H,7-9,13H2,1-2H3 |
| InChIKey | NDSNUFLJPUXGSJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|