C13H14F4N4 — CID 115350611
N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine (PubChem CID 115350611) has the molecular formula C13H14F4N4 and a molecular weight of 302.28 g/mol. Its IUPAC name is N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine.
| Compound Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 115350611 |
| Molecular Formula | C13H14F4N4 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-(4-methyl-1,2,4-triazol-3-yl)ethanamine |
| SMILES | Cn1cnnc1CCNCc1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H14F4N4/c1-21-8-19-20-12(21)2-3-18-7-9-4-10(13(15,16)17)6-11(14)5-9/h4-6,8,18H,2-3,7H2,1H3 |
| InChIKey | HSIBVJKKQNYETG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|