C12H12F2N2S — CID 116789344
2,2-difluoro-2-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine (PubChem CID 116789344) has the molecular formula C12H12F2N2S and a molecular weight of 254.31 g/mol. Its IUPAC name is 2,2-difluoro-2-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine.
| Compound Name | 2,2-difluoro-2-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 116789344 |
| Molecular Formula | C12H12F2N2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2,2-difluoro-2-phenyl-N-(1,3-thiazol-5-ylmethyl)ethanamine |
| SMILES | FC(F)(CNCc1cncs1)c1ccccc1 |
| InChI | InChI=1S/C12H12F2N2S/c13-12(14,10-4-2-1-3-5-10)8-15-6-11-7-16-9-17-11/h1-5,7,9,15H,6,8H2 |
| InChIKey | LSQZXIPGESBDAJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |