C14H15Cl2NS — CID 112645411
5-[2-benzyl-3-chloro-2-(chloromethyl)propyl]-1,3-thiazole (PubChem CID 112645411) has the molecular formula C14H15Cl2NS and a molecular weight of 300.25 g/mol. Its IUPAC name is 5-[2-benzyl-3-chloro-2-(chloromethyl)propyl]-1,3-thiazole.
| Compound Name | 5-[2-benzyl-3-chloro-2-(chloromethyl)propyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112645411 |
| Molecular Formula | C14H15Cl2NS |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 5-[2-benzyl-3-chloro-2-(chloromethyl)propyl]-1,3-thiazole |
| SMILES | ClCC(CCl)(Cc1ccccc1)Cc1cncs1 |
| InChI | InChI=1S/C14H15Cl2NS/c15-9-14(10-16,7-13-8-17-11-18-13)6-12-4-2-1-3-5-12/h1-5,8,11H,6-7,9-10H2 |
| InChIKey | WGOJXHJECQBADF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|