C13H20ClNO — CID 115625573
3-chloro-2-[(3,3-dimethylbutylamino)methyl]phenol (PubChem CID 115625573) has the molecular formula C13H20ClNO and a molecular weight of 241.76 g/mol. Its IUPAC name is 3-chloro-2-[(3,3-dimethylbutylamino)methyl]phenol.
| Compound Name | 3-chloro-2-[(3,3-dimethylbutylamino)methyl]phenol |
|---|---|
| PubChem CID | 115625573 |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.76 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 3-chloro-2-[(3,3-dimethylbutylamino)methyl]phenol |
| SMILES | CC(C)(C)CCNCc1c(O)cccc1Cl |
| InChI | InChI=1S/C13H20ClNO/c1-13(2,3)7-8-15-9-10-11(14)5-4-6-12(10)16/h4-6,15-16H,7-9H2,1-3H3 |
| InChIKey | OLJCGYLQKLIURI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|