C11H18Cl4N2O — CID 17294838
2-[2-[(2,6-dichlorophenyl)methylamino]ethylamino]ethanol;dihydrochloride (PubChem CID 17294838) has the molecular formula C11H18Cl4N2O and a molecular weight of 336.09 g/mol. Its IUPAC name is 2-[2-[(2,6-dichlorophenyl)methylamino]ethylamino]ethanol;dihydrochloride.
| Compound Name | 2-[2-[(2,6-dichlorophenyl)methylamino]ethylamino]ethanol;dihydrochloride |
|---|---|
| PubChem CID | 17294838 |
| Molecular Formula | C11H18Cl4N2O |
| Molecular Weight | 336.09 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 2-[2-[(2,6-dichlorophenyl)methylamino]ethylamino]ethanol;dihydrochloride |
| SMILES | Cl.Cl.OCCNCCNCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H16Cl2N2O.2ClH/c12-10-2-1-3-11(13)9(10)8-15-5-4-14-6-7-16;;/h1-3,14-16H,4-8H2;2*1H |
| InChIKey | VGSJJWWJYXMKBI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.09 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|