C15H19NOS — CID 55013040
N-[(2,5-dimethylthiophen-3-yl)methyl]-2-phenoxyethanamine (PubChem CID 55013040) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(2,5-dimethylthiophen-3-yl)methyl]-2-phenoxyethanamine.
| Compound Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-phenoxyethanamine |
|---|---|
| PubChem CID | 55013040 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-phenoxyethanamine |
| SMILES | Cc1cc(CNCCOc2ccccc2)c(C)s1 |
| InChI | InChI=1S/C15H19NOS/c1-12-10-14(13(2)18-12)11-16-8-9-17-15-6-4-3-5-7-15/h3-7,10,16H,8-9,11H2,1-2H3 |
| InChIKey | WEHNLQRUTQURFW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|