C16H24FN3 — CID 28568695
3-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-4-fluorobenzonitrile (PubChem CID 28568695) has the molecular formula C16H24FN3 and a molecular weight of 277.39 g/mol. Its IUPAC name is 3-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-4-fluorobenzonitrile.
| Compound Name | 3-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 28568695 |
| Molecular Formula | C16H24FN3 |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 3-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-4-fluorobenzonitrile |
| SMILES | CC(C)N(CCNCc1cc(C#N)ccc1F)C(C)C |
| InChI | InChI=1S/C16H24FN3/c1-12(2)20(13(3)4)8-7-19-11-15-9-14(10-18)5-6-16(15)17/h5-6,9,12-13,19H,7-8,11H2,1-4H3 |
| InChIKey | GGSQDBDVZDIATA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|