C9H13N3O2S2 — CID 79553000
N-[2-[(4-cyanothiophen-2-yl)methylamino]ethyl]methanesulfonamide (PubChem CID 79553000) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is N-[2-[(4-cyanothiophen-2-yl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(4-cyanothiophen-2-yl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 79553000 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-[2-[(4-cyanothiophen-2-yl)methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1cc(C#N)cs1 |
| InChI | InChI=1S/C9H13N3O2S2/c1-16(13,14)12-3-2-11-6-9-4-8(5-10)7-15-9/h4,7,11-12H,2-3,6H2,1H3 |
| InChIKey | JLCHOZIKKNONJW-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|