C10H13N3OS — CID 79613775
4-[(4-cyanothiophen-2-yl)methylamino]butanamide (PubChem CID 79613775) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-[(4-cyanothiophen-2-yl)methylamino]butanamide.
| Compound Name | 4-[(4-cyanothiophen-2-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 79613775 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-[(4-cyanothiophen-2-yl)methylamino]butanamide |
| SMILES | N#Cc1csc(CNCCCC(N)=O)c1 |
| InChI | InChI=1S/C10H13N3OS/c11-5-8-4-9(15-7-8)6-13-3-1-2-10(12)14/h4,7,13H,1-3,6H2,(H2,12,14) |
| InChIKey | UHICGYDWBUKFJE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|