C11H13FN2 — CID 60677065
2-[ethyl-[(3-fluorophenyl)methyl]amino]acetonitrile (PubChem CID 60677065) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-[ethyl-[(3-fluorophenyl)methyl]amino]acetonitrile.
| Compound Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]acetonitrile |
|---|---|
| PubChem CID | 60677065 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 2-[ethyl-[(3-fluorophenyl)methyl]amino]acetonitrile |
| SMILES | CCN(CC#N)Cc1cccc(F)c1 |
| InChI | InChI=1S/C11H13FN2/c1-2-14(7-6-13)9-10-4-3-5-11(12)8-10/h3-5,8H,2,7,9H2,1H3 |
| InChIKey | AYLWWCZKQPCTKK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|