C11H12Cl2N2 — CID 61035372
2-[(3,4-dichlorophenyl)methyl-ethylamino]acetonitrile (PubChem CID 61035372) has the molecular formula C11H12Cl2N2 and a molecular weight of 243.14 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)methyl-ethylamino]acetonitrile.
| Compound Name | 2-[(3,4-dichlorophenyl)methyl-ethylamino]acetonitrile |
|---|---|
| PubChem CID | 61035372 |
| Molecular Formula | C11H12Cl2N2 |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)methyl-ethylamino]acetonitrile |
| SMILES | CCN(CC#N)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2/c1-2-15(6-5-14)8-9-3-4-10(12)11(13)7-9/h3-4,7H,2,6,8H2,1H3 |
| InChIKey | WLSFISGJYMFEBR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|