About 1H-indol-5-ylazanide;tungsten
1H-indol-5-ylazanide;tungsten (PubChem CID 155742475) has the molecular formula C8H7N2W-
and a molecular weight of 315.00 g/mol. Its IUPAC name is 1H-indol-5-ylazanide;tungsten.
Molecular Properties
| Compound Name | 1H-indol-5-ylazanide;tungsten |
| PubChem CID | 155742475 |
| Molecular Formula | C8H7N2W- |
| Molecular Weight | 315.00 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 1H-indol-5-ylazanide;tungsten |
| SMILES | [NH-]c1ccc2[nH]ccc2c1.[W] |
| InChI | InChI=1S/C8H7N2.W/c9-7-1-2-8-6(5-7)3-4-10-8;/h1-5,9-10H;/q-1; |
| InChIKey | RRGWYYVFWCDKNN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 39.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.00 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1H-indol-5-ylazanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-5-ylazanide;tungsten?
The IUPAC name of 1H-indol-5-ylazanide;tungsten (CID 155742475) is 1H-indol-5-ylazanide;tungsten.
What is the SMILES notation for 1H-indol-5-ylazanide;tungsten?
The canonical SMILES for 1H-indol-5-ylazanide;tungsten is [NH-]c1ccc2[nH]ccc2c1.[W].
What is the InChIKey of 1H-indol-5-ylazanide;tungsten?
The InChIKey is RRGWYYVFWCDKNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.W/c9-7-1-2-8-6(5-7)3-4-10-8;/h1-5,9-10H;/q-1;.
What are the key properties of 1H-indol-5-ylazanide;tungsten?
1H-indol-5-ylazanide;tungsten has a molecular weight of 315.00 g/mol, XLogP of 2.85, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-5-ylazanide;tungsten is sourced from PubChem (CID 155742475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).