C24H22N6O3 — CID 68981840
4-[2-[[4-(1H-indol-5-ylamino)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylic acid (PubChem CID 68981840) has the molecular formula C24H22N6O3 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-[2-[[4-(1H-indol-5-ylamino)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-[[4-(1H-indol-5-ylamino)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68981840 |
| Molecular Formula | C24H22N6O3 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-[2-[[4-(1H-indol-5-ylamino)quinazolin-6-yl]amino]-2-oxoethylidene]piperidine-1-carboxylic acid |
| SMILES | O=C(C=C1CCN(C(=O)O)CC1)Nc1ccc2ncnc(Nc3ccc4[nH]ccc4c3)c2c1 |
| InChI | InChI=1S/C24H22N6O3/c31-22(11-15-6-9-30(10-7-15)24(32)33)28-18-2-4-21-19(13-18)23(27-14-26-21)29-17-1-3-20-16(12-17)5-8-25-20/h1-5,8,11-14,25H,6-7,9-10H2,(H,28,31)(H,32,33)(H,26,27,29) |
| InChIKey | UPGNIUUHVCSAIH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|