C20H22ClN3O2S — CID 163762319
7-(2-chloroethoxy)-N-[4-(ethylsulfanylmethyl)phenyl]-6-methoxyquinazolin-4-amine (PubChem CID 163762319) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 7-(2-chloroethoxy)-N-[4-(ethylsulfanylmethyl)phenyl]-6-methoxyquinazolin-4-amine.
| Compound Name | 7-(2-chloroethoxy)-N-[4-(ethylsulfanylmethyl)phenyl]-6-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 163762319 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 7-(2-chloroethoxy)-N-[4-(ethylsulfanylmethyl)phenyl]-6-methoxyquinazolin-4-amine |
| SMILES | CCSCc1ccc(Nc2ncnc3cc(OCCCl)c(OC)cc23)cc1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-3-27-12-14-4-6-15(7-5-14)24-20-16-10-18(25-2)19(26-9-8-21)11-17(16)22-13-23-20/h4-7,10-11,13H,3,8-9,12H2,1-2H3,(H,22,23,24) |
| InChIKey | LZFVZLVNRYDNOV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|