C24H29N5O5 — CID 165147958
4-(3,4-dimethoxyanilino)-N-[7-(hydroxyamino)-7-oxoheptyl]quinazoline-7-carboxamide (PubChem CID 165147958) has the molecular formula C24H29N5O5 and a molecular weight of 467.53 g/mol. Its IUPAC name is 4-(3,4-dimethoxyanilino)-N-[7-(hydroxyamino)-7-oxoheptyl]quinazoline-7-carboxamide.
| Compound Name | 4-(3,4-dimethoxyanilino)-N-[7-(hydroxyamino)-7-oxoheptyl]quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 165147958 |
| Molecular Formula | C24H29N5O5 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 4-(3,4-dimethoxyanilino)-N-[7-(hydroxyamino)-7-oxoheptyl]quinazoline-7-carboxamide |
| SMILES | COc1ccc(Nc2ncnc3cc(C(=O)NCCCCCCC(=O)NO)ccc23)cc1OC |
| InChI | InChI=1S/C24H29N5O5/c1-33-20-11-9-17(14-21(20)34-2)28-23-18-10-8-16(13-19(18)26-15-27-23)24(31)25-12-6-4-3-5-7-22(30)29-32/h8-11,13-15,32H,3-7,12H2,1-2H3,(H,25,31)(H,29,30)(H,26,27,28) |
| InChIKey | NGWBAMTZYDXCFW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|