C25H32N4O6 — CID 171419876
tert-butyl N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]carbamate (PubChem CID 171419876) has the molecular formula C25H32N4O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is tert-butyl N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 171419876 |
| Molecular Formula | C25H32N4O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | tert-butyl N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]carbamate |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(NC(=O)OC(C)(C)C)cc3)c2cc1OCCOC |
| InChI | InChI=1S/C25H32N4O6/c1-25(2,3)35-24(30)29-18-8-6-17(7-9-18)28-23-19-14-21(33-12-10-31-4)22(34-13-11-32-5)15-20(19)26-16-27-23/h6-9,14-16H,10-13H2,1-5H3,(H,29,30)(H,26,27,28) |
| InChIKey | AUZXAJGTGUWFLB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|