C23H27N3O4 — CID 141410537
6,7-bis(2-methoxyethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine (PubChem CID 141410537) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 6,7-bis(2-methoxyethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine.
| Compound Name | 6,7-bis(2-methoxyethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 141410537 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 6,7-bis(2-methoxyethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine |
| SMILES | C/C=C/c1ccc(Nc2ncnc3cc(OCCOC)c(OCCOC)cc23)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-4-5-17-6-8-18(9-7-17)26-23-19-14-21(29-12-10-27-2)22(30-13-11-28-3)15-20(19)24-16-25-23/h4-9,14-16H,10-13H2,1-3H3,(H,24,25,26)/b5-4+ |
| InChIKey | JGUSQLYXUGGEOI-SNAWJCMRSA-N |
| XLogP | 4.46 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|