C19H18ClN3O — CID 141410555
6-(2-chloroethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine (PubChem CID 141410555) has the molecular formula C19H18ClN3O and a molecular weight of 339.83 g/mol. Its IUPAC name is 6-(2-chloroethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine.
| Compound Name | 6-(2-chloroethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 141410555 |
| Molecular Formula | C19H18ClN3O |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 6-(2-chloroethoxy)-N-[4-[(E)-prop-1-enyl]phenyl]quinazolin-4-amine |
| SMILES | C/C=C/c1ccc(Nc2ncnc3ccc(OCCCl)cc23)cc1 |
| InChI | InChI=1S/C19H18ClN3O/c1-2-3-14-4-6-15(7-5-14)23-19-17-12-16(24-11-10-20)8-9-18(17)21-13-22-19/h2-9,12-13H,10-11H2,1H3,(H,21,22,23)/b3-2+ |
| InChIKey | ZKVLSHOVQQCEAO-NSCUHMNNSA-N |
| XLogP | 5.02 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|