C29H34N4O3 — CID 69231840
ethyl 7-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanoate (PubChem CID 69231840) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is ethyl 7-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanoate.
| Compound Name | ethyl 7-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanoate |
|---|---|
| PubChem CID | 69231840 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | ethyl 7-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]heptanoate |
| SMILES | CCOC(=O)CCCCCCOc1ccc(-c2cc3c(NC(C)c4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C29H34N4O3/c1-3-35-27(34)13-9-4-5-10-18-36-24-16-14-23(15-17-24)26-19-25-28(30-20-31-29(25)33-26)32-21(2)22-11-7-6-8-12-22/h6-8,11-12,14-17,19-21H,3-5,9-10,13,18H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | HWWSAFBLVVFGAD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|