C26H29N5O2 — CID 69234296
6-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanoic acid (PubChem CID 69234296) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 6-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanoic acid.
| Compound Name | 6-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanoic acid |
|---|---|
| PubChem CID | 69234296 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 6-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanoic acid |
| SMILES | CC(Nc1ncnc2[nH]c(-c3ccc(NCCCCCC(=O)O)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C26H29N5O2/c1-18(19-8-4-2-5-9-19)30-25-22-16-23(31-26(22)29-17-28-25)20-11-13-21(14-12-20)27-15-7-3-6-10-24(32)33/h2,4-5,8-9,11-14,16-18,27H,3,6-7,10,15H2,1H3,(H,32,33)(H2,28,29,30,31) |
| InChIKey | LURUOPBXKCIHDZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|