C31H39N7O2 — CID 24900442
N-hydroxy-6-[4-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]hexanamide (PubChem CID 24900442) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is N-hydroxy-6-[4-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]hexanamide.
| Compound Name | N-hydroxy-6-[4-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]hexanamide |
|---|---|
| PubChem CID | 24900442 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | N-hydroxy-6-[4-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]hexanamide |
| SMILES | C[C@@H](Nc1ncnc2[nH]c(-c3ccc(CN4CCN(CCCCCC(=O)NO)CC4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C31H39N7O2/c1-23(25-8-4-2-5-9-25)34-30-27-20-28(35-31(27)33-22-32-30)26-13-11-24(12-14-26)21-38-18-16-37(17-19-38)15-7-3-6-10-29(39)36-40/h2,4-5,8-9,11-14,20,22-23,40H,3,6-7,10,15-19,21H2,1H3,(H,36,39)(H2,32,33,34,35)/t23-/m1/s1 |
| InChIKey | NKQVVPNGDOFUHY-HSZRJFAPSA-N |
| XLogP | 4.98 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|