C30H37N7O2 — CID 24900897
N-hydroxy-4-[[1-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperidin-4-yl]amino]butanamide (PubChem CID 24900897) has the molecular formula C30H37N7O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is N-hydroxy-4-[[1-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperidin-4-yl]amino]butanamide.
| Compound Name | N-hydroxy-4-[[1-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperidin-4-yl]amino]butanamide |
|---|---|
| PubChem CID | 24900897 |
| Molecular Formula | C30H37N7O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | N-hydroxy-4-[[1-[[4-[4-[[(1R)-1-phenylethyl]amino]-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperidin-4-yl]amino]butanamide |
| SMILES | C[C@@H](Nc1ncnc2[nH]c(-c3ccc(CN4CCC(NCCCC(=O)NO)CC4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C30H37N7O2/c1-21(23-6-3-2-4-7-23)34-29-26-18-27(35-30(26)33-20-32-29)24-11-9-22(10-12-24)19-37-16-13-25(14-17-37)31-15-5-8-28(38)36-39/h2-4,6-7,9-12,18,20-21,25,31,39H,5,8,13-17,19H2,1H3,(H,36,38)(H2,32,33,34,35)/t21-/m1/s1 |
| InChIKey | LHDXYMTUWFBBGF-OAQYLSRUSA-N |
| XLogP | 4.64 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|