C29H28N6O2 — CID 72553944
N-hydroxy-4-[[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]benzamide (PubChem CID 72553944) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is N-hydroxy-4-[[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]benzamide.
| Compound Name | N-hydroxy-4-[[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]benzamide |
|---|---|
| PubChem CID | 72553944 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | N-hydroxy-4-[[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methylamino]methyl]benzamide |
| SMILES | CC(Nc1ncnc2[nH]c(-c3ccc(CNCc4ccc(C(=O)NO)cc4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C29H28N6O2/c1-19(22-5-3-2-4-6-22)33-27-25-15-26(34-28(25)32-18-31-27)23-11-7-20(8-12-23)16-30-17-21-9-13-24(14-10-21)29(36)35-37/h2-15,18-19,30,37H,16-17H2,1H3,(H,35,36)(H2,31,32,33,34) |
| InChIKey | ZMEJPUFHDFOMJY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|