C25H26N4O3 — CID 69234366
methyl 4-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]butanoate (PubChem CID 69234366) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is methyl 4-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 69234366 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | methyl 4-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(-c2cc3c(NC(C)c4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C25H26N4O3/c1-17(18-7-4-3-5-8-18)28-24-21-15-22(29-25(21)27-16-26-24)19-10-12-20(13-11-19)32-14-6-9-23(30)31-2/h3-5,7-8,10-13,15-17H,6,9,14H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | HIEWQUIJIQWFSK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|