C30H37N5O3 — CID 91261960
7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoic acid (PubChem CID 91261960) has the molecular formula C30H37N5O3 and a molecular weight of 515.66 g/mol. Its IUPAC name is 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoic acid.
| Compound Name | 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoic acid |
|---|---|
| PubChem CID | 91261960 |
| Molecular Formula | C30H37N5O3 |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoic acid |
| SMILES | CC(Nc1ncnc2[nH]c(-c3ccc(OCCCNCCCCCCC(=O)O)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C30H37N5O3/c1-22(23-10-5-4-6-11-23)34-29-26-20-27(35-30(26)33-21-32-29)24-13-15-25(16-14-24)38-19-9-18-31-17-8-3-2-7-12-28(36)37/h4-6,10-11,13-16,20-22,31H,2-3,7-9,12,17-19H2,1H3,(H,36,37)(H2,32,33,34,35) |
| InChIKey | WDTCFKULWKUXER-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|