C29H34N6O3 — CID 69234374
6-[2-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzoyl]amino]ethylamino]hexanoic acid (PubChem CID 69234374) has the molecular formula C29H34N6O3 and a molecular weight of 514.63 g/mol. Its IUPAC name is 6-[2-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzoyl]amino]ethylamino]hexanoic acid.
| Compound Name | 6-[2-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzoyl]amino]ethylamino]hexanoic acid |
|---|---|
| PubChem CID | 69234374 |
| Molecular Formula | C29H34N6O3 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 6-[2-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzoyl]amino]ethylamino]hexanoic acid |
| SMILES | CC(Nc1ncnc2[nH]c(-c3ccc(C(=O)NCCNCCCCCC(=O)O)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C29H34N6O3/c1-20(21-8-4-2-5-9-21)34-27-24-18-25(35-28(24)33-19-32-27)22-11-13-23(14-12-22)29(38)31-17-16-30-15-7-3-6-10-26(36)37/h2,4-5,8-9,11-14,18-20,30H,3,6-7,10,15-17H2,1H3,(H,31,38)(H,36,37)(H2,32,33,34,35) |
| InChIKey | XAHNESNTUDLTJL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|