C31H39N5O3 — CID 69234367
methyl 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoate (PubChem CID 69234367) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is methyl 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoate.
| Compound Name | methyl 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoate |
|---|---|
| PubChem CID | 69234367 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | methyl 7-[3-[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenoxy]propylamino]heptanoate |
| SMILES | COC(=O)CCCCCCNCCCOc1ccc(-c2cc3c(NC(C)c4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C31H39N5O3/c1-23(24-11-6-5-7-12-24)35-30-27-21-28(36-31(27)34-22-33-30)25-14-16-26(17-15-25)39-20-10-19-32-18-9-4-3-8-13-29(37)38-2/h5-7,11-12,14-17,21-23,32H,3-4,8-10,13,18-20H2,1-2H3,(H2,33,34,35,36) |
| InChIKey | VJIZRDISUVJLIK-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|