C33H42N6O3 — CID 91344629
6-[2-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]hexanoic acid (PubChem CID 91344629) has the molecular formula C33H42N6O3 and a molecular weight of 570.74 g/mol. Its IUPAC name is 6-[2-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]hexanoic acid.
| Compound Name | 6-[2-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]hexanoic acid |
|---|---|
| PubChem CID | 91344629 |
| Molecular Formula | C33H42N6O3 |
| Molecular Weight | 570.74 g/mol |
| Exact Mass | 570.33 |
| IUPAC Name | 6-[2-[4-[[4-[4-(1-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]methyl]piperazin-1-yl]ethoxy]hexanoic acid |
| SMILES | CC(Nc1ncnc2[nH]c(-c3ccc(CN4CCN(CCOCCCCCC(=O)O)CC4)cc3)cc12)c1ccccc1 |
| InChI | InChI=1S/C33H42N6O3/c1-25(27-8-4-2-5-9-27)36-32-29-22-30(37-33(29)35-24-34-32)28-13-11-26(12-14-28)23-39-17-15-38(16-18-39)19-21-42-20-7-3-6-10-31(40)41/h2,4-5,8-9,11-14,22,24-25H,3,6-7,10,15-21,23H2,1H3,(H,40,41)(H2,34,35,36,37) |
| InChIKey | MNGKXEYKYMJXIQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.74 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|