C25H28N6O — CID 143645665
6-[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanamide (PubChem CID 143645665) has the molecular formula C25H28N6O and a molecular weight of 428.54 g/mol. Its IUPAC name is 6-[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanamide.
| Compound Name | 6-[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanamide |
|---|---|
| PubChem CID | 143645665 |
| Molecular Formula | C25H28N6O |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 6-[4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]hexanamide |
| SMILES | NC(=O)CCCCCNc1ccc(-c2cc3c(NCc4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C25H28N6O/c26-23(32)9-5-2-6-14-27-20-12-10-19(11-13-20)22-15-21-24(29-17-30-25(21)31-22)28-16-18-7-3-1-4-8-18/h1,3-4,7-8,10-13,15,17,27H,2,5-6,9,14,16H2,(H2,26,32)(H2,28,29,30,31) |
| InChIKey | RRTGLCODEZAONX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|