C28H31N5O3 — CID 69164350
8-oxo-8-[4-[4-(2-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]octanoic acid (PubChem CID 69164350) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 8-oxo-8-[4-[4-(2-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]octanoic acid.
| Compound Name | 8-oxo-8-[4-[4-(2-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]octanoic acid |
|---|---|
| PubChem CID | 69164350 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 8-oxo-8-[4-[4-(2-phenylethylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]octanoic acid |
| SMILES | O=C(O)CCCCCCC(=O)Nc1ccc(-c2cc3c(NCCc4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C28H31N5O3/c34-25(10-6-1-2-7-11-26(35)36)32-22-14-12-21(13-15-22)24-18-23-27(30-19-31-28(23)33-24)29-17-16-20-8-4-3-5-9-20/h3-5,8-9,12-15,18-19H,1-2,6-7,10-11,16-17H2,(H,32,34)(H,35,36)(H2,29,30,31,33) |
| InChIKey | BFLONXIGPIVIAK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|