C28H31N5O3 — CID 69164345
8-[4-[4-(N-ethylanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-8-oxooctanoic acid (PubChem CID 69164345) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is 8-[4-[4-(N-ethylanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-8-oxooctanoic acid.
| Compound Name | 8-[4-[4-(N-ethylanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 69164345 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | 8-[4-[4-(N-ethylanilino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]anilino]-8-oxooctanoic acid |
| SMILES | CCN(c1ccccc1)c1ncnc2[nH]c(-c3ccc(NC(=O)CCCCCCC(=O)O)cc3)cc12 |
| InChI | InChI=1S/C28H31N5O3/c1-2-33(22-10-6-5-7-11-22)28-23-18-24(32-27(23)29-19-30-28)20-14-16-21(17-15-20)31-25(34)12-8-3-4-9-13-26(35)36/h5-7,10-11,14-19H,2-4,8-9,12-13H2,1H3,(H,31,34)(H,35,36)(H,29,30,32) |
| InChIKey | IOPUWHLKOICAGY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|