C20H21N5O3 — CID 69463489
[3-[[4-(N-ethylanilino)quinazolin-6-yl]amino]-3-oxopropyl]carbamic acid (PubChem CID 69463489) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is [3-[[4-(N-ethylanilino)quinazolin-6-yl]amino]-3-oxopropyl]carbamic acid.
| Compound Name | [3-[[4-(N-ethylanilino)quinazolin-6-yl]amino]-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 69463489 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [3-[[4-(N-ethylanilino)quinazolin-6-yl]amino]-3-oxopropyl]carbamic acid |
| SMILES | CCN(c1ccccc1)c1ncnc2ccc(NC(=O)CCNC(=O)O)cc12 |
| InChI | InChI=1S/C20H21N5O3/c1-2-25(15-6-4-3-5-7-15)19-16-12-14(8-9-17(16)22-13-23-19)24-18(26)10-11-21-20(27)28/h3-9,12-13,21H,2,10-11H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | VYIOKTJORHAUFJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |