C22H25N3O3 — CID 68729366
6-[4-(N-ethylanilino)quinazolin-6-yl]oxyhexanoic acid (PubChem CID 68729366) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is 6-[4-(N-ethylanilino)quinazolin-6-yl]oxyhexanoic acid.
| Compound Name | 6-[4-(N-ethylanilino)quinazolin-6-yl]oxyhexanoic acid |
|---|---|
| PubChem CID | 68729366 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 6-[4-(N-ethylanilino)quinazolin-6-yl]oxyhexanoic acid |
| SMILES | CCN(c1ccccc1)c1ncnc2ccc(OCCCCCC(=O)O)cc12 |
| InChI | InChI=1S/C22H25N3O3/c1-2-25(17-9-5-3-6-10-17)22-19-15-18(12-13-20(19)23-16-24-22)28-14-8-4-7-11-21(26)27/h3,5-6,9-10,12-13,15-16H,2,4,7-8,11,14H2,1H3,(H,26,27) |
| InChIKey | CGQPQUMJUPHUFI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|