C22H25N5O4S — CID 69462798
N-[4-(N-ethylanilino)quinazolin-6-yl]-3-[(2-methylsulfonylacetyl)amino]propanamide (PubChem CID 69462798) has the molecular formula C22H25N5O4S and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[4-(N-ethylanilino)quinazolin-6-yl]-3-[(2-methylsulfonylacetyl)amino]propanamide.
| Compound Name | N-[4-(N-ethylanilino)quinazolin-6-yl]-3-[(2-methylsulfonylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 69462798 |
| Molecular Formula | C22H25N5O4S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[4-(N-ethylanilino)quinazolin-6-yl]-3-[(2-methylsulfonylacetyl)amino]propanamide |
| SMILES | CCN(c1ccccc1)c1ncnc2ccc(NC(=O)CCNC(=O)CS(C)(=O)=O)cc12 |
| InChI | InChI=1S/C22H25N5O4S/c1-3-27(17-7-5-4-6-8-17)22-18-13-16(9-10-19(18)24-15-25-22)26-20(28)11-12-23-21(29)14-32(2,30)31/h4-10,13,15H,3,11-12,14H2,1-2H3,(H,23,29)(H,26,28) |
| InChIKey | UDIFGELKWZETFS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |