C30H39N7O2 — CID 143645477
4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzaldehyde;7-[2-(methylamino)ethylamino]heptanamide (PubChem CID 143645477) has the molecular formula C30H39N7O2 and a molecular weight of 529.69 g/mol. Its IUPAC name is 4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzaldehyde;7-[2-(methylamino)ethylamino]heptanamide.
| Compound Name | 4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzaldehyde;7-[2-(methylamino)ethylamino]heptanamide |
|---|---|
| PubChem CID | 143645477 |
| Molecular Formula | C30H39N7O2 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.32 |
| IUPAC Name | 4-[4-(benzylamino)-7H-pyrrolo[2,3-d]pyrimidin-6-yl]benzaldehyde;7-[2-(methylamino)ethylamino]heptanamide |
| SMILES | CNCCNCCCCCCC(N)=O.O=Cc1ccc(-c2cc3c(NCc4ccccc4)ncnc3[nH]2)cc1 |
| InChI | InChI=1S/C20H16N4O.C10H23N3O/c25-12-15-6-8-16(9-7-15)18-10-17-19(22-13-23-20(17)24-18)21-11-14-4-2-1-3-5-14;1-12-8-9-13-7-5-3-2-4-6-10(11)14/h1-10,12-13H,11H2,(H2,21,22,23,24);12-13H,2-9H2,1H3,(H2,11,14) |
| InChIKey | WTWDGHGTAOXEQA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|