C24H22N4O8S — CID 11584517
4-[4-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]oxybenzenesulfonamide (PubChem CID 11584517) has the molecular formula C24H22N4O8S and a molecular weight of 526.53 g/mol. Its IUPAC name is 4-[4-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]oxybenzenesulfonamide.
| Compound Name | 4-[4-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]oxybenzenesulfonamide |
|---|---|
| PubChem CID | 11584517 |
| Molecular Formula | C24H22N4O8S |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | 4-[4-[[6-methoxy-7-(2-methoxyethoxy)quinazolin-4-yl]amino]-3,6-dioxocyclohexa-1,4-dien-1-yl]oxybenzenesulfonamide |
| SMILES | COCCOc1cc2ncnc(NC3=CC(=O)C(Oc4ccc(S(N)(=O)=O)cc4)=CC3=O)c2cc1OC |
| InChI | InChI=1S/C24H22N4O8S/c1-33-7-8-35-23-11-17-16(9-22(23)34-2)24(27-13-26-17)28-18-10-20(30)21(12-19(18)29)36-14-3-5-15(6-4-14)37(25,31)32/h3-6,9-13H,7-8H2,1-2H3,(H2,25,31,32)(H,26,27,28) |
| InChIKey | JASKZBKLEDWNSC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 169.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|