C30H33N5O2 — CID 143782824
9-[5-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]-1H-imidazol-2-yl]nonan-3-one (PubChem CID 143782824) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 9-[5-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]-1H-imidazol-2-yl]nonan-3-one.
| Compound Name | 9-[5-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]-1H-imidazol-2-yl]nonan-3-one |
|---|---|
| PubChem CID | 143782824 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 9-[5-[[4-(3-ethynylanilino)-7-methoxyquinazolin-6-yl]methyl]-1H-imidazol-2-yl]nonan-3-one |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(Cc4cnc(CCCCCCC(=O)CC)[nH]4)cc23)c1 |
| InChI | InChI=1S/C30H33N5O2/c1-4-21-11-10-12-23(15-21)35-30-26-17-22(28(37-3)18-27(26)32-20-33-30)16-24-19-31-29(34-24)14-9-7-6-8-13-25(36)5-2/h1,10-12,15,17-20H,5-9,13-14,16H2,2-3H3,(H,31,34)(H,32,33,35) |
| InChIKey | DTDMQIRRFVWAMT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|